C13H19ClIN5OS — CID 119141942
1-[(5-chlorothiophen-2-yl)methyl]-3-[2-hydroxy-2-(1-methylpyrazol-4-yl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 119141942) has the molecular formula C13H19ClIN5OS and a molecular weight of 455.75 g/mol. Its IUPAC name is 1-[(5-chlorothiophen-2-yl)methyl]-3-[2-hydroxy-2-(1-methylpyrazol-4-yl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(5-chlorothiophen-2-yl)methyl]-3-[2-hydroxy-2-(1-methylpyrazol-4-yl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119141942 |
| Molecular Formula | C13H19ClIN5OS |
| Molecular Weight | 455.75 g/mol |
| Exact Mass | 455.00 |
| IUPAC Name | 1-[(5-chlorothiophen-2-yl)methyl]-3-[2-hydroxy-2-(1-methylpyrazol-4-yl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(Cl)s1)NCC(O)c1cnn(C)c1.I |
| InChI | InChI=1S/C13H18ClN5OS.HI/c1-15-13(16-6-10-3-4-12(14)21-10)17-7-11(20)9-5-18-19(2)8-9;/h3-5,8,11,20H,6-7H2,1-2H3,(H2,15,16,17);1H |
| InChIKey | VYUSJFBLCNRGBV-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 74.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.75 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|