C11H19BrIN5O — CID 119142006
1-(2-bromoprop-2-enyl)-3-[2-hydroxy-2-(1-methylpyrazol-4-yl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 119142006) has the molecular formula C11H19BrIN5O and a molecular weight of 444.12 g/mol. Its IUPAC name is 1-(2-bromoprop-2-enyl)-3-[2-hydroxy-2-(1-methylpyrazol-4-yl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-(2-bromoprop-2-enyl)-3-[2-hydroxy-2-(1-methylpyrazol-4-yl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119142006 |
| Molecular Formula | C11H19BrIN5O |
| Molecular Weight | 444.12 g/mol |
| Exact Mass | 442.98 |
| IUPAC Name | 1-(2-bromoprop-2-enyl)-3-[2-hydroxy-2-(1-methylpyrazol-4-yl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C=C(Br)CN/C(=N\C)NCC(O)c1cnn(C)c1.I |
| InChI | InChI=1S/C11H18BrN5O.HI/c1-8(12)4-14-11(13-2)15-6-10(18)9-5-16-17(3)7-9;/h5,7,10,18H,1,4,6H2,2-3H3,(H2,13,14,15);1H |
| InChIKey | VIFLMVXWIOPAAW-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 74.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.12 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|