C15H20BrFIN5O — CID 119141958
1-[(2-bromo-5-fluorophenyl)methyl]-3-[2-hydroxy-2-(1-methylpyrazol-4-yl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 119141958) has the molecular formula C15H20BrFIN5O and a molecular weight of 512.17 g/mol. Its IUPAC name is 1-[(2-bromo-5-fluorophenyl)methyl]-3-[2-hydroxy-2-(1-methylpyrazol-4-yl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(2-bromo-5-fluorophenyl)methyl]-3-[2-hydroxy-2-(1-methylpyrazol-4-yl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119141958 |
| Molecular Formula | C15H20BrFIN5O |
| Molecular Weight | 512.17 g/mol |
| Exact Mass | 510.99 |
| IUPAC Name | 1-[(2-bromo-5-fluorophenyl)methyl]-3-[2-hydroxy-2-(1-methylpyrazol-4-yl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cc(F)ccc1Br)NCC(O)c1cnn(C)c1.I |
| InChI | InChI=1S/C15H19BrFN5O.HI/c1-18-15(19-6-10-5-12(17)3-4-13(10)16)20-8-14(23)11-7-21-22(2)9-11;/h3-5,7,9,14,23H,6,8H2,1-2H3,(H2,18,19,20);1H |
| InChIKey | PBGHGUCQGDKNKA-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 74.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.17 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|