C13H21IN6OS — CID 119141956
1-[2-hydroxy-2-(1-methylpyrazol-4-yl)ethyl]-2-methyl-3-[(2-methyl-1,3-thiazol-5-yl)methyl]guanidine;hydroiodide (PubChem CID 119141956) has the molecular formula C13H21IN6OS and a molecular weight of 436.32 g/mol. Its IUPAC name is 1-[2-hydroxy-2-(1-methylpyrazol-4-yl)ethyl]-2-methyl-3-[(2-methyl-1,3-thiazol-5-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-hydroxy-2-(1-methylpyrazol-4-yl)ethyl]-2-methyl-3-[(2-methyl-1,3-thiazol-5-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119141956 |
| Molecular Formula | C13H21IN6OS |
| Molecular Weight | 436.32 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | 1-[2-hydroxy-2-(1-methylpyrazol-4-yl)ethyl]-2-methyl-3-[(2-methyl-1,3-thiazol-5-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1cnc(C)s1)NCC(O)c1cnn(C)c1.I |
| InChI | InChI=1S/C13H20N6OS.HI/c1-9-15-5-11(21-9)6-16-13(14-2)17-7-12(20)10-4-18-19(3)8-10;/h4-5,8,12,20H,6-7H2,1-3H3,(H2,14,16,17);1H |
| InChIKey | JPILRVHOYGIQNC-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.32 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|