C22H26N4S — CID 111233819
1-(3,3-diphenylpropyl)-2-methyl-3-[(2-methyl-1,3-thiazol-5-yl)methyl]guanidine (PubChem CID 111233819) has the molecular formula C22H26N4S and a molecular weight of 378.55 g/mol. Its IUPAC name is 1-(3,3-diphenylpropyl)-2-methyl-3-[(2-methyl-1,3-thiazol-5-yl)methyl]guanidine.
| Compound Name | 1-(3,3-diphenylpropyl)-2-methyl-3-[(2-methyl-1,3-thiazol-5-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111233819 |
| Molecular Formula | C22H26N4S |
| Molecular Weight | 378.55 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 1-(3,3-diphenylpropyl)-2-methyl-3-[(2-methyl-1,3-thiazol-5-yl)methyl]guanidine |
| SMILES | C/N=C(/NCCC(c1ccccc1)c1ccccc1)NCc1cnc(C)s1 |
| InChI | InChI=1S/C22H26N4S/c1-17-25-15-20(27-17)16-26-22(23-2)24-14-13-21(18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-12,15,21H,13-14,16H2,1-2H3,(H2,23,24,26) |
| InChIKey | QAWTXRPSSFRMNK-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|