C10H16F3IN4S — CID 109471054
2-methyl-1-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 109471054) has the molecular formula C10H16F3IN4S and a molecular weight of 408.23 g/mol. Its IUPAC name is 2-methyl-1-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109471054 |
| Molecular Formula | C10H16F3IN4S |
| Molecular Weight | 408.23 g/mol |
| Exact Mass | 408.01 |
| IUPAC Name | 2-methyl-1-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCC(F)(F)F)NCc1cnc(C)s1.I |
| InChI | InChI=1S/C10H15F3N4S.HI/c1-7-16-5-8(18-7)6-17-9(14-2)15-4-3-10(11,12)13;/h5H,3-4,6H2,1-2H3,(H2,14,15,17);1H |
| InChIKey | ODBLJZMUVGQEHJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.23 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|