C11H20IN5OS — CID 119133045
N,N-dimethyl-2-[[N'-methyl-N-[(2-methyl-1,3-thiazol-5-yl)methyl]carbamimidoyl]amino]acetamide;hydroiodide (PubChem CID 119133045) has the molecular formula C11H20IN5OS and a molecular weight of 397.29 g/mol. Its IUPAC name is N,N-dimethyl-2-[[N'-methyl-N-[(2-methyl-1,3-thiazol-5-yl)methyl]carbamimidoyl]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[N'-methyl-N-[(2-methyl-1,3-thiazol-5-yl)methyl]carbamimidoyl]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 119133045 |
| Molecular Formula | C11H20IN5OS |
| Molecular Weight | 397.29 g/mol |
| Exact Mass | 397.04 |
| IUPAC Name | N,N-dimethyl-2-[[N'-methyl-N-[(2-methyl-1,3-thiazol-5-yl)methyl]carbamimidoyl]amino]acetamide;hydroiodide |
| SMILES | C/N=C(\NCC(=O)N(C)C)NCc1cnc(C)s1.I |
| InChI | InChI=1S/C11H19N5OS.HI/c1-8-13-5-9(18-8)6-14-11(12-2)15-7-10(17)16(3)4;/h5H,6-7H2,1-4H3,(H2,12,14,15);1H |
| InChIKey | ONWKPJCNDIEXDO-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.29 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|