C11H18BrIN4OS — CID 119132963
2-[[N-[(5-bromothiophen-2-yl)methyl]-N'-methylcarbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 119132963) has the molecular formula C11H18BrIN4OS and a molecular weight of 461.17 g/mol. Its IUPAC name is 2-[[N-[(5-bromothiophen-2-yl)methyl]-N'-methylcarbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[N-[(5-bromothiophen-2-yl)methyl]-N'-methylcarbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 119132963 |
| Molecular Formula | C11H18BrIN4OS |
| Molecular Weight | 461.17 g/mol |
| Exact Mass | 459.94 |
| IUPAC Name | 2-[[N-[(5-bromothiophen-2-yl)methyl]-N'-methylcarbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | C/N=C(\NCC(=O)N(C)C)NCc1ccc(Br)s1.I |
| InChI | InChI=1S/C11H17BrN4OS.HI/c1-13-11(15-7-10(17)16(2)3)14-6-8-4-5-9(12)18-8;/h4-5H,6-7H2,1-3H3,(H2,13,14,15);1H |
| InChIKey | XYZSCLTUVXZNKY-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.17 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|