C12H21IN4OS — CID 119133035
N,N-dimethyl-2-[[N'-methyl-N-[(5-methylthiophen-2-yl)methyl]carbamimidoyl]amino]acetamide;hydroiodide (PubChem CID 119133035) has the molecular formula C12H21IN4OS and a molecular weight of 396.30 g/mol. Its IUPAC name is N,N-dimethyl-2-[[N'-methyl-N-[(5-methylthiophen-2-yl)methyl]carbamimidoyl]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[N'-methyl-N-[(5-methylthiophen-2-yl)methyl]carbamimidoyl]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 119133035 |
| Molecular Formula | C12H21IN4OS |
| Molecular Weight | 396.30 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | N,N-dimethyl-2-[[N'-methyl-N-[(5-methylthiophen-2-yl)methyl]carbamimidoyl]amino]acetamide;hydroiodide |
| SMILES | C/N=C(\NCC(=O)N(C)C)NCc1ccc(C)s1.I |
| InChI | InChI=1S/C12H20N4OS.HI/c1-9-5-6-10(18-9)7-14-12(13-2)15-8-11(17)16(3)4;/h5-6H,7-8H2,1-4H3,(H2,13,14,15);1H |
| InChIKey | KDZLLEVLPLKQTP-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.30 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|