C14H26N4O2S2 — CID 111999435
1-[2-(diethylsulfamoyl)ethyl]-2-methyl-3-[(5-methylthiophen-2-yl)methyl]guanidine (PubChem CID 111999435) has the molecular formula C14H26N4O2S2 and a molecular weight of 346.52 g/mol. Its IUPAC name is 1-[2-(diethylsulfamoyl)ethyl]-2-methyl-3-[(5-methylthiophen-2-yl)methyl]guanidine.
| Compound Name | 1-[2-(diethylsulfamoyl)ethyl]-2-methyl-3-[(5-methylthiophen-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111999435 |
| Molecular Formula | C14H26N4O2S2 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 1-[2-(diethylsulfamoyl)ethyl]-2-methyl-3-[(5-methylthiophen-2-yl)methyl]guanidine |
| SMILES | CCN(CC)S(=O)(=O)CCN/C(=N\C)NCc1ccc(C)s1 |
| InChI | InChI=1S/C14H26N4O2S2/c1-5-18(6-2)22(19,20)10-9-16-14(15-4)17-11-13-8-7-12(3)21-13/h7-8H,5-6,9-11H2,1-4H3,(H2,15,16,17) |
| InChIKey | CWYWNVASWFEAKQ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|