C15H25ClN4O2S — CID 111761803
1-[(3-chlorophenyl)methyl]-3-[2-(diethylsulfamoyl)ethyl]-2-methylguanidine (PubChem CID 111761803) has the molecular formula C15H25ClN4O2S and a molecular weight of 360.91 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-3-[2-(diethylsulfamoyl)ethyl]-2-methylguanidine.
| Compound Name | 1-[(3-chlorophenyl)methyl]-3-[2-(diethylsulfamoyl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111761803 |
| Molecular Formula | C15H25ClN4O2S |
| Molecular Weight | 360.91 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-3-[2-(diethylsulfamoyl)ethyl]-2-methylguanidine |
| SMILES | CCN(CC)S(=O)(=O)CCN/C(=N\C)NCc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H25ClN4O2S/c1-4-20(5-2)23(21,22)10-9-18-15(17-3)19-12-13-7-6-8-14(16)11-13/h6-8,11H,4-5,9-10,12H2,1-3H3,(H2,17,18,19) |
| InChIKey | HHZIHJFWRJDBBE-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.91 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|