C18H24ClIN4O2S — CID 111358075
1-[2-(3-chlorophenyl)ethyl]-2-methyl-3-[[3-(methylsulfamoyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111358075) has the molecular formula C18H24ClIN4O2S and a molecular weight of 522.84 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)ethyl]-2-methyl-3-[[3-(methylsulfamoyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(3-chlorophenyl)ethyl]-2-methyl-3-[[3-(methylsulfamoyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111358075 |
| Molecular Formula | C18H24ClIN4O2S |
| Molecular Weight | 522.84 g/mol |
| Exact Mass | 522.04 |
| IUPAC Name | 1-[2-(3-chlorophenyl)ethyl]-2-methyl-3-[[3-(methylsulfamoyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1cccc(Cl)c1)NCc1cccc(S(=O)(=O)NC)c1.I |
| InChI | InChI=1S/C18H23ClN4O2S.HI/c1-20-18(22-10-9-14-5-3-7-16(19)11-14)23-13-15-6-4-8-17(12-15)26(24,25)21-2;/h3-8,11-12,21H,9-10,13H2,1-2H3,(H2,20,22,23);1H |
| InChIKey | WHNSDBPCOOVNTN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.84 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|