C18H33N5O2S — CID 111247529
1-[2-[di(propan-2-yl)amino]ethyl]-2-methyl-3-[[3-(methylsulfamoyl)phenyl]methyl]guanidine (PubChem CID 111247529) has the molecular formula C18H33N5O2S and a molecular weight of 383.56 g/mol. Its IUPAC name is 1-[2-[di(propan-2-yl)amino]ethyl]-2-methyl-3-[[3-(methylsulfamoyl)phenyl]methyl]guanidine.
| Compound Name | 1-[2-[di(propan-2-yl)amino]ethyl]-2-methyl-3-[[3-(methylsulfamoyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111247529 |
| Molecular Formula | C18H33N5O2S |
| Molecular Weight | 383.56 g/mol |
| Exact Mass | 383.24 |
| IUPAC Name | 1-[2-[di(propan-2-yl)amino]ethyl]-2-methyl-3-[[3-(methylsulfamoyl)phenyl]methyl]guanidine |
| SMILES | C/N=C(\NCCN(C(C)C)C(C)C)NCc1cccc(S(=O)(=O)NC)c1 |
| InChI | InChI=1S/C18H33N5O2S/c1-14(2)23(15(3)4)11-10-21-18(19-5)22-13-16-8-7-9-17(12-16)26(24,25)20-6/h7-9,12,14-15,20H,10-11,13H2,1-6H3,(H2,19,21,22) |
| InChIKey | OIJHUYRMAJSVOJ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.56 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|