C16H23IN4O3S — CID 111354941
1-[2-(furan-2-yl)ethyl]-2-methyl-3-[[3-(methylsulfamoyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111354941) has the molecular formula C16H23IN4O3S and a molecular weight of 478.36 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)ethyl]-2-methyl-3-[[3-(methylsulfamoyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(furan-2-yl)ethyl]-2-methyl-3-[[3-(methylsulfamoyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111354941 |
| Molecular Formula | C16H23IN4O3S |
| Molecular Weight | 478.36 g/mol |
| Exact Mass | 478.05 |
| IUPAC Name | 1-[2-(furan-2-yl)ethyl]-2-methyl-3-[[3-(methylsulfamoyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1ccco1)NCc1cccc(S(=O)(=O)NC)c1.I |
| InChI | InChI=1S/C16H22N4O3S.HI/c1-17-16(19-9-8-14-6-4-10-23-14)20-12-13-5-3-7-15(11-13)24(21,22)18-2;/h3-7,10-11,18H,8-9,12H2,1-2H3,(H2,17,19,20);1H |
| InChIKey | WVTPLZGGKMJQIQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 95.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.36 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|