C17H23IN4O2 — CID 111354021
N-[3-[[[N-[2-(furan-2-yl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]acetamide;hydroiodide (PubChem CID 111354021) has the molecular formula C17H23IN4O2 and a molecular weight of 442.30 g/mol. Its IUPAC name is N-[3-[[[N-[2-(furan-2-yl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]acetamide;hydroiodide.
| Compound Name | N-[3-[[[N-[2-(furan-2-yl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111354021 |
| Molecular Formula | C17H23IN4O2 |
| Molecular Weight | 442.30 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | N-[3-[[[N-[2-(furan-2-yl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]acetamide;hydroiodide |
| SMILES | C/N=C(\NCCc1ccco1)NCc1cccc(NC(C)=O)c1.I |
| InChI | InChI=1S/C17H22N4O2.HI/c1-13(22)21-15-6-3-5-14(11-15)12-20-17(18-2)19-9-8-16-7-4-10-23-16;/h3-7,10-11H,8-9,12H2,1-2H3,(H,21,22)(H2,18,19,20);1H |
| InChIKey | POPMHJBITYEODX-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.30 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|