C17H26IN5O3S — CID 111584776
2-methyl-1-[[3-(methylsulfamoyl)phenyl]methyl]-3-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide (PubChem CID 111584776) has the molecular formula C17H26IN5O3S and a molecular weight of 507.40 g/mol. Its IUPAC name is 2-methyl-1-[[3-(methylsulfamoyl)phenyl]methyl]-3-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[[3-(methylsulfamoyl)phenyl]methyl]-3-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111584776 |
| Molecular Formula | C17H26IN5O3S |
| Molecular Weight | 507.40 g/mol |
| Exact Mass | 507.08 |
| IUPAC Name | 2-methyl-1-[[3-(methylsulfamoyl)phenyl]methyl]-3-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cccc(S(=O)(=O)NC)c1)NCc1cc(C(C)C)no1.I |
| InChI | InChI=1S/C17H25N5O3S.HI/c1-12(2)16-9-14(25-22-16)11-21-17(18-3)20-10-13-6-5-7-15(8-13)26(23,24)19-4;/h5-9,12,19H,10-11H2,1-4H3,(H2,18,20,21);1H |
| InChIKey | NJEPXITWOIZILG-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 108.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|