C15H20N4O3S — CID 110933933
1-(furan-2-ylmethyl)-2-methyl-3-[[3-(methylsulfamoyl)phenyl]methyl]guanidine (PubChem CID 110933933) has the molecular formula C15H20N4O3S and a molecular weight of 336.42 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-2-methyl-3-[[3-(methylsulfamoyl)phenyl]methyl]guanidine.
| Compound Name | 1-(furan-2-ylmethyl)-2-methyl-3-[[3-(methylsulfamoyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 110933933 |
| Molecular Formula | C15H20N4O3S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 1-(furan-2-ylmethyl)-2-methyl-3-[[3-(methylsulfamoyl)phenyl]methyl]guanidine |
| SMILES | C/N=C(/NCc1cccc(S(=O)(=O)NC)c1)NCc1ccco1 |
| InChI | InChI=1S/C15H20N4O3S/c1-16-15(19-11-13-6-4-8-22-13)18-10-12-5-3-7-14(9-12)23(20,21)17-2/h3-9,17H,10-11H2,1-2H3,(H2,16,18,19) |
| InChIKey | MFLDDIDFDDLLDI-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 95.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|