C14H26IN5S — CID 111416732
2-methyl-1-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-(2-piperidin-1-ylethyl)guanidine;hydroiodide (PubChem CID 111416732) has the molecular formula C14H26IN5S and a molecular weight of 423.37 g/mol. Its IUPAC name is 2-methyl-1-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-(2-piperidin-1-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-(2-piperidin-1-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111416732 |
| Molecular Formula | C14H26IN5S |
| Molecular Weight | 423.37 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | 2-methyl-1-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-(2-piperidin-1-ylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCN1CCCCC1)NCc1cnc(C)s1.I |
| InChI | InChI=1S/C14H25N5S.HI/c1-12-17-10-13(20-12)11-18-14(15-2)16-6-9-19-7-4-3-5-8-19;/h10H,3-9,11H2,1-2H3,(H2,15,16,18);1H |
| InChIKey | YXHRUOAUGUJJAQ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.37 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|