C15H21ClIN5S — CID 119143749
N-[(5-chlorothiophen-2-yl)methyl]-N'-methyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 119143749) has the molecular formula C15H21ClIN5S and a molecular weight of 465.79 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-N'-methyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-N'-methyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119143749 |
| Molecular Formula | C15H21ClIN5S |
| Molecular Weight | 465.79 g/mol |
| Exact Mass | 465.03 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-N'-methyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(Cl)s1)N1CCC(c2cnn(C)c2)C1.I |
| InChI | InChI=1S/C15H20ClN5S.HI/c1-17-15(18-8-13-3-4-14(16)22-13)21-6-5-11(10-21)12-7-19-20(2)9-12;/h3-4,7,9,11H,5-6,8,10H2,1-2H3,(H,17,18);1H |
| InChIKey | NXRVZRFJBGWQSL-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.79 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|