C15H15ClN4O — CID 133323516
2-[(6-chloroquinolin-4-yl)amino]-1-(1-methylpyrazol-4-yl)ethanol (PubChem CID 133323516) has the molecular formula C15H15ClN4O and a molecular weight of 302.77 g/mol. Its IUPAC name is 2-[(6-chloroquinolin-4-yl)amino]-1-(1-methylpyrazol-4-yl)ethanol.
| Compound Name | 2-[(6-chloroquinolin-4-yl)amino]-1-(1-methylpyrazol-4-yl)ethanol |
|---|---|
| PubChem CID | 133323516 |
| Molecular Formula | C15H15ClN4O |
| Molecular Weight | 302.77 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 2-[(6-chloroquinolin-4-yl)amino]-1-(1-methylpyrazol-4-yl)ethanol |
| SMILES | Cn1cc(C(O)CNc2ccnc3ccc(Cl)cc23)cn1 |
| InChI | InChI=1S/C15H15ClN4O/c1-20-9-10(7-19-20)15(21)8-18-14-4-5-17-13-3-2-11(16)6-12(13)14/h2-7,9,15,21H,8H2,1H3,(H,17,18) |
| InChIKey | UUODWMFNSZLDFM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.77 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |