C17H14ClFN2O — CID 133351580
2-[(7-chloroquinolin-4-yl)amino]-1-(2-fluorophenyl)ethanol (PubChem CID 133351580) has the molecular formula C17H14ClFN2O and a molecular weight of 316.76 g/mol. Its IUPAC name is 2-[(7-chloroquinolin-4-yl)amino]-1-(2-fluorophenyl)ethanol.
| Compound Name | 2-[(7-chloroquinolin-4-yl)amino]-1-(2-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 133351580 |
| Molecular Formula | C17H14ClFN2O |
| Molecular Weight | 316.76 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 2-[(7-chloroquinolin-4-yl)amino]-1-(2-fluorophenyl)ethanol |
| SMILES | OC(CNc1ccnc2cc(Cl)ccc12)c1ccccc1F |
| InChI | InChI=1S/C17H14ClFN2O/c18-11-5-6-13-15(7-8-20-16(13)9-11)21-10-17(22)12-3-1-2-4-14(12)19/h1-9,17,22H,10H2,(H,20,21) |
| InChIKey | YJYUVTMPHZUWSF-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.76 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |