C14H15ClN2O2 — CID 65223950
2-[[(7-chloroquinolin-4-yl)amino]methyl]butanoic acid (PubChem CID 65223950) has the molecular formula C14H15ClN2O2 and a molecular weight of 278.74 g/mol. Its IUPAC name is 2-[[(7-chloroquinolin-4-yl)amino]methyl]butanoic acid.
| Compound Name | 2-[[(7-chloroquinolin-4-yl)amino]methyl]butanoic acid |
|---|---|
| PubChem CID | 65223950 |
| Molecular Formula | C14H15ClN2O2 |
| Molecular Weight | 278.74 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 2-[[(7-chloroquinolin-4-yl)amino]methyl]butanoic acid |
| SMILES | CCC(CNc1ccnc2cc(Cl)ccc12)C(=O)O |
| InChI | InChI=1S/C14H15ClN2O2/c1-2-9(14(18)19)8-17-12-5-6-16-13-7-10(15)3-4-11(12)13/h3-7,9H,2,8H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | UYEORZPYPDZWJV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.74 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |