C16H21ClN2O — CID 103705122
3-[[(7-chloroquinolin-4-yl)amino]methyl]hexan-1-ol (PubChem CID 103705122) has the molecular formula C16H21ClN2O and a molecular weight of 292.81 g/mol. Its IUPAC name is 3-[[(7-chloroquinolin-4-yl)amino]methyl]hexan-1-ol.
| Compound Name | 3-[[(7-chloroquinolin-4-yl)amino]methyl]hexan-1-ol |
|---|---|
| PubChem CID | 103705122 |
| Molecular Formula | C16H21ClN2O |
| Molecular Weight | 292.81 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 3-[[(7-chloroquinolin-4-yl)amino]methyl]hexan-1-ol |
| SMILES | CCCC(CCO)CNc1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C16H21ClN2O/c1-2-3-12(7-9-20)11-19-15-6-8-18-16-10-13(17)4-5-14(15)16/h4-6,8,10,12,20H,2-3,7,9,11H2,1H3,(H,18,19) |
| InChIKey | LIUSQAYBSCCTNF-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.81 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |