C16H25ClN3O5P — CID 54599799
1-[(7-chloroquinolin-4-yl)amino]-3-(diethylamino)propan-2-ol;phosphoric acid (PubChem CID 54599799) has the molecular formula C16H25ClN3O5P and a molecular weight of 405.82 g/mol. Its IUPAC name is 1-[(7-chloroquinolin-4-yl)amino]-3-(diethylamino)propan-2-ol;phosphoric acid.
| Compound Name | 1-[(7-chloroquinolin-4-yl)amino]-3-(diethylamino)propan-2-ol;phosphoric acid |
|---|---|
| PubChem CID | 54599799 |
| Molecular Formula | C16H25ClN3O5P |
| Molecular Weight | 405.82 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 1-[(7-chloroquinolin-4-yl)amino]-3-(diethylamino)propan-2-ol;phosphoric acid |
| SMILES | CCN(CC)CC(O)CNc1ccnc2cc(Cl)ccc12.O=P(O)(O)O |
| InChI | InChI=1S/C16H22ClN3O.H3O4P/c1-3-20(4-2)11-13(21)10-19-15-7-8-18-16-9-12(17)5-6-14(15)16;1-5(2,3)4/h5-9,13,21H,3-4,10-11H2,1-2H3,(H,18,19);(H3,1,2,3,4) |
| InChIKey | GWVKGTRIWYRUKB-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 126.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.82 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|