C26H33ClFN5O — CID 56950680
1-[4-[(7-chloroquinolin-4-yl)amino]butylamino]-3-[4-(2-fluorophenyl)piperazin-1-yl]propan-2-ol (PubChem CID 56950680) has the molecular formula C26H33ClFN5O and a molecular weight of 486.04 g/mol. Its IUPAC name is 1-[4-[(7-chloroquinolin-4-yl)amino]butylamino]-3-[4-(2-fluorophenyl)piperazin-1-yl]propan-2-ol.
| Compound Name | 1-[4-[(7-chloroquinolin-4-yl)amino]butylamino]-3-[4-(2-fluorophenyl)piperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 56950680 |
| Molecular Formula | C26H33ClFN5O |
| Molecular Weight | 486.04 g/mol |
| Exact Mass | 485.24 |
| IUPAC Name | 1-[4-[(7-chloroquinolin-4-yl)amino]butylamino]-3-[4-(2-fluorophenyl)piperazin-1-yl]propan-2-ol |
| SMILES | OC(CNCCCCNc1ccnc2cc(Cl)ccc12)CN1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C26H33ClFN5O/c27-20-7-8-22-24(9-12-31-25(22)17-20)30-11-4-3-10-29-18-21(34)19-32-13-15-33(16-14-32)26-6-2-1-5-23(26)28/h1-2,5-9,12,17,21,29,34H,3-4,10-11,13-16,18-19H2,(H,30,31) |
| InChIKey | YFACGOSYKURXJM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 63.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.04 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|