C21H22ClN5O2 — CID 52949780
7-chloro-N-[2-[4-(2-nitrophenyl)piperazin-1-yl]ethyl]quinolin-4-amine (PubChem CID 52949780) has the molecular formula C21H22ClN5O2 and a molecular weight of 411.89 g/mol. Its IUPAC name is 7-chloro-N-[2-[4-(2-nitrophenyl)piperazin-1-yl]ethyl]quinolin-4-amine.
| Compound Name | 7-chloro-N-[2-[4-(2-nitrophenyl)piperazin-1-yl]ethyl]quinolin-4-amine |
|---|---|
| PubChem CID | 52949780 |
| Molecular Formula | C21H22ClN5O2 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 7-chloro-N-[2-[4-(2-nitrophenyl)piperazin-1-yl]ethyl]quinolin-4-amine |
| SMILES | O=[N+]([O-])c1ccccc1N1CCN(CCNc2ccnc3cc(Cl)ccc23)CC1 |
| InChI | InChI=1S/C21H22ClN5O2/c22-16-5-6-17-18(7-8-23-19(17)15-16)24-9-10-25-11-13-26(14-12-25)20-3-1-2-4-21(20)27(28)29/h1-8,15H,9-14H2,(H,23,24) |
| InChIKey | JTMLJKIXHOMLQN-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 74.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|