C25H31ClFN5O — CID 71594573
(2R)-1-[3-[(7-chloroquinolin-4-yl)amino]propylamino]-3-[4-(2-fluorophenyl)piperazin-1-yl]propan-2-ol (PubChem CID 71594573) has the molecular formula C25H31ClFN5O and a molecular weight of 472.01 g/mol. Its IUPAC name is (2R)-1-[3-[(7-chloroquinolin-4-yl)amino]propylamino]-3-[4-(2-fluorophenyl)piperazin-1-yl]propan-2-ol.
| Compound Name | (2R)-1-[3-[(7-chloroquinolin-4-yl)amino]propylamino]-3-[4-(2-fluorophenyl)piperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 71594573 |
| Molecular Formula | C25H31ClFN5O |
| Molecular Weight | 472.01 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | (2R)-1-[3-[(7-chloroquinolin-4-yl)amino]propylamino]-3-[4-(2-fluorophenyl)piperazin-1-yl]propan-2-ol |
| SMILES | O[C@H](CNCCCNc1ccnc2cc(Cl)ccc12)CN1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C25H31ClFN5O/c26-19-6-7-21-23(8-11-30-24(21)16-19)29-10-3-9-28-17-20(33)18-31-12-14-32(15-13-31)25-5-2-1-4-22(25)27/h1-2,4-8,11,16,20,28,33H,3,9-10,12-15,17-18H2,(H,29,30)/t20-/m1/s1 |
| InChIKey | VVDLOBZBQPVMGW-HXUWFJFHSA-N |
| XLogP | 3.60 |
| TPSA | 63.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.01 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|