C24H29ClFN5O — CID 71594568
(2S)-1-[2-[(7-chloroquinolin-4-yl)amino]ethylamino]-3-[4-(4-fluorophenyl)piperazin-1-yl]propan-2-ol (PubChem CID 71594568) has the molecular formula C24H29ClFN5O and a molecular weight of 457.98 g/mol. Its IUPAC name is (2S)-1-[2-[(7-chloroquinolin-4-yl)amino]ethylamino]-3-[4-(4-fluorophenyl)piperazin-1-yl]propan-2-ol.
| Compound Name | (2S)-1-[2-[(7-chloroquinolin-4-yl)amino]ethylamino]-3-[4-(4-fluorophenyl)piperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 71594568 |
| Molecular Formula | C24H29ClFN5O |
| Molecular Weight | 457.98 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | (2S)-1-[2-[(7-chloroquinolin-4-yl)amino]ethylamino]-3-[4-(4-fluorophenyl)piperazin-1-yl]propan-2-ol |
| SMILES | O[C@@H](CNCCNc1ccnc2cc(Cl)ccc12)CN1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C24H29ClFN5O/c25-18-1-6-22-23(7-8-28-24(22)15-18)29-10-9-27-16-21(32)17-30-11-13-31(14-12-30)20-4-2-19(26)3-5-20/h1-8,15,21,27,32H,9-14,16-17H2,(H,28,29)/t21-/m0/s1 |
| InChIKey | WBGYKRYMHGZGCB-NRFANRHFSA-N |
| XLogP | 3.21 |
| TPSA | 63.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.98 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|