C16H20F3N3O2 — CID 86797745
3-[(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)amino]-4-(trifluoromethyl)benzonitrile (PubChem CID 86797745) has the molecular formula C16H20F3N3O2 and a molecular weight of 343.35 g/mol. Its IUPAC name is 3-[(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)amino]-4-(trifluoromethyl)benzonitrile.
| Compound Name | 3-[(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)amino]-4-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 86797745 |
| Molecular Formula | C16H20F3N3O2 |
| Molecular Weight | 343.35 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 3-[(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)amino]-4-(trifluoromethyl)benzonitrile |
| SMILES | CC(O)(CNc1cc(C#N)ccc1C(F)(F)F)CN1CCOCC1 |
| InChI | InChI=1S/C16H20F3N3O2/c1-15(23,11-22-4-6-24-7-5-22)10-21-14-8-12(9-20)2-3-13(14)16(17,18)19/h2-3,8,21,23H,4-7,10-11H2,1H3 |
| InChIKey | NIHUWXICTUBCAO-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.35 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |