C14H15F3N2O — CID 125138104
3-[[(2S,4S)-2-methyloxan-4-yl]amino]-4-(trifluoromethyl)benzonitrile (PubChem CID 125138104) has the molecular formula C14H15F3N2O and a molecular weight of 284.28 g/mol. Its IUPAC name is 3-[[(2S,4S)-2-methyloxan-4-yl]amino]-4-(trifluoromethyl)benzonitrile.
| Compound Name | 3-[[(2S,4S)-2-methyloxan-4-yl]amino]-4-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 125138104 |
| Molecular Formula | C14H15F3N2O |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 3-[[(2S,4S)-2-methyloxan-4-yl]amino]-4-(trifluoromethyl)benzonitrile |
| SMILES | C[C@H]1C[C@@H](Nc2cc(C#N)ccc2C(F)(F)F)CCO1 |
| InChI | InChI=1S/C14H15F3N2O/c1-9-6-11(4-5-20-9)19-13-7-10(8-18)2-3-12(13)14(15,16)17/h2-3,7,9,11,19H,4-6H2,1H3/t9-,11-/m0/s1 |
| InChIKey | RQXLDPQGDLAXLE-ONGXEEELSA-N |
| XLogP | 3.56 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |