C13H16F3NO3S — CID 103889248
2-methyl-N-[2-(trifluoromethylsulfonyl)phenyl]oxan-4-amine (PubChem CID 103889248) has the molecular formula C13H16F3NO3S and a molecular weight of 323.34 g/mol. Its IUPAC name is 2-methyl-N-[2-(trifluoromethylsulfonyl)phenyl]oxan-4-amine.
| Compound Name | 2-methyl-N-[2-(trifluoromethylsulfonyl)phenyl]oxan-4-amine |
|---|---|
| PubChem CID | 103889248 |
| Molecular Formula | C13H16F3NO3S |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 2-methyl-N-[2-(trifluoromethylsulfonyl)phenyl]oxan-4-amine |
| SMILES | CC1CC(Nc2ccccc2S(=O)(=O)C(F)(F)F)CCO1 |
| InChI | InChI=1S/C13H16F3NO3S/c1-9-8-10(6-7-20-9)17-11-4-2-3-5-12(11)21(18,19)13(14,15)16/h2-5,9-10,17H,6-8H2,1H3 |
| InChIKey | MHOAWTRYGNHMFZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |