C14H18F3NO2S — CID 64921633
N-(2,3-dimethylcyclopentyl)-2-(trifluoromethylsulfonyl)aniline (PubChem CID 64921633) has the molecular formula C14H18F3NO2S and a molecular weight of 321.36 g/mol. Its IUPAC name is N-(2,3-dimethylcyclopentyl)-2-(trifluoromethylsulfonyl)aniline.
| Compound Name | N-(2,3-dimethylcyclopentyl)-2-(trifluoromethylsulfonyl)aniline |
|---|---|
| PubChem CID | 64921633 |
| Molecular Formula | C14H18F3NO2S |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | N-(2,3-dimethylcyclopentyl)-2-(trifluoromethylsulfonyl)aniline |
| SMILES | CC1CCC(Nc2ccccc2S(=O)(=O)C(F)(F)F)C1C |
| InChI | InChI=1S/C14H18F3NO2S/c1-9-7-8-11(10(9)2)18-12-5-3-4-6-13(12)21(19,20)14(15,16)17/h3-6,9-11,18H,7-8H2,1-2H3 |
| InChIKey | UNQGKBVVVWLVJE-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |