C14H19F2NO2S — CID 64922621
2-(difluoromethylsulfonyl)-N-(2,3-dimethylcyclopentyl)aniline (PubChem CID 64922621) has the molecular formula C14H19F2NO2S and a molecular weight of 303.37 g/mol. Its IUPAC name is 2-(difluoromethylsulfonyl)-N-(2,3-dimethylcyclopentyl)aniline.
| Compound Name | 2-(difluoromethylsulfonyl)-N-(2,3-dimethylcyclopentyl)aniline |
|---|---|
| PubChem CID | 64922621 |
| Molecular Formula | C14H19F2NO2S |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 2-(difluoromethylsulfonyl)-N-(2,3-dimethylcyclopentyl)aniline |
| SMILES | CC1CCC(Nc2ccccc2S(=O)(=O)C(F)F)C1C |
| InChI | InChI=1S/C14H19F2NO2S/c1-9-7-8-11(10(9)2)17-12-5-3-4-6-13(12)20(18,19)14(15)16/h3-6,9-11,14,17H,7-8H2,1-2H3 |
| InChIKey | KEAZHEIFEMGBAQ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |