C13H13F2NO4S — CID 79192554
4-[2-(difluoromethylsulfonyl)anilino]cyclopent-2-ene-1-carboxylic acid (PubChem CID 79192554) has the molecular formula C13H13F2NO4S and a molecular weight of 317.31 g/mol. Its IUPAC name is 4-[2-(difluoromethylsulfonyl)anilino]cyclopent-2-ene-1-carboxylic acid.
| Compound Name | 4-[2-(difluoromethylsulfonyl)anilino]cyclopent-2-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 79192554 |
| Molecular Formula | C13H13F2NO4S |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 4-[2-(difluoromethylsulfonyl)anilino]cyclopent-2-ene-1-carboxylic acid |
| SMILES | O=C(O)C1C=CC(Nc2ccccc2S(=O)(=O)C(F)F)C1 |
| InChI | InChI=1S/C13H13F2NO4S/c14-13(15)21(19,20)11-4-2-1-3-10(11)16-9-6-5-8(7-9)12(17)18/h1-6,8-9,13,16H,7H2,(H,17,18) |
| InChIKey | LNHSBUVGLPMXKK-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|