C17H18F2N2O3S — CID 133298500
N-benzyl-2-[2-(difluoromethylsulfonyl)anilino]propanamide (PubChem CID 133298500) has the molecular formula C17H18F2N2O3S and a molecular weight of 368.41 g/mol. Its IUPAC name is N-benzyl-2-[2-(difluoromethylsulfonyl)anilino]propanamide.
| Compound Name | N-benzyl-2-[2-(difluoromethylsulfonyl)anilino]propanamide |
|---|---|
| PubChem CID | 133298500 |
| Molecular Formula | C17H18F2N2O3S |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | N-benzyl-2-[2-(difluoromethylsulfonyl)anilino]propanamide |
| SMILES | CC(Nc1ccccc1S(=O)(=O)C(F)F)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C17H18F2N2O3S/c1-12(16(22)20-11-13-7-3-2-4-8-13)21-14-9-5-6-10-15(14)25(23,24)17(18)19/h2-10,12,17,21H,11H2,1H3,(H,20,22) |
| InChIKey | VLKVUJGOGTXSLQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |