C25H23F2N7O — CID 41284505
(2S)-N-benzyl-2-[[4,6-bis(2-fluoroanilino)-1,3,5-triazin-2-yl]amino]propanamide (PubChem CID 41284505) has the molecular formula C25H23F2N7O and a molecular weight of 475.50 g/mol. Its IUPAC name is (2S)-N-benzyl-2-[[4,6-bis(2-fluoroanilino)-1,3,5-triazin-2-yl]amino]propanamide.
| Compound Name | (2S)-N-benzyl-2-[[4,6-bis(2-fluoroanilino)-1,3,5-triazin-2-yl]amino]propanamide |
|---|---|
| PubChem CID | 41284505 |
| Molecular Formula | C25H23F2N7O |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | (2S)-N-benzyl-2-[[4,6-bis(2-fluoroanilino)-1,3,5-triazin-2-yl]amino]propanamide |
| SMILES | C[C@H](Nc1nc(Nc2ccccc2F)nc(Nc2ccccc2F)n1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C25H23F2N7O/c1-16(22(35)28-15-17-9-3-2-4-10-17)29-23-32-24(30-20-13-7-5-11-18(20)26)34-25(33-23)31-21-14-8-6-12-19(21)27/h2-14,16H,15H2,1H3,(H,28,35)(H3,29,30,31,32,33,34)/t16-/m0/s1 |
| InChIKey | WNDQOXORYKIDHS-INIZCTEOSA-N |
| XLogP | 4.75 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |