C13H11BrF3NO2 — CID 79215953
4-[4-bromo-2-(trifluoromethyl)anilino]cyclopent-2-ene-1-carboxylic acid (PubChem CID 79215953) has the molecular formula C13H11BrF3NO2 and a molecular weight of 350.13 g/mol. Its IUPAC name is 4-[4-bromo-2-(trifluoromethyl)anilino]cyclopent-2-ene-1-carboxylic acid.
| Compound Name | 4-[4-bromo-2-(trifluoromethyl)anilino]cyclopent-2-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 79215953 |
| Molecular Formula | C13H11BrF3NO2 |
| Molecular Weight | 350.13 g/mol |
| Exact Mass | 348.99 |
| IUPAC Name | 4-[4-bromo-2-(trifluoromethyl)anilino]cyclopent-2-ene-1-carboxylic acid |
| SMILES | O=C(O)C1C=CC(Nc2ccc(Br)cc2C(F)(F)F)C1 |
| InChI | InChI=1S/C13H11BrF3NO2/c14-8-2-4-11(10(6-8)13(15,16)17)18-9-3-1-7(5-9)12(19)20/h1-4,6-7,9,18H,5H2,(H,19,20) |
| InChIKey | SKVLKNKJXHKOLU-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.13 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|