C14H15BrF3NO2 — CID 65484778
2-[4-bromo-2-(trifluoromethyl)anilino]cyclohexane-1-carboxylic acid (PubChem CID 65484778) has the molecular formula C14H15BrF3NO2 and a molecular weight of 366.18 g/mol. Its IUPAC name is 2-[4-bromo-2-(trifluoromethyl)anilino]cyclohexane-1-carboxylic acid.
| Compound Name | 2-[4-bromo-2-(trifluoromethyl)anilino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 65484778 |
| Molecular Formula | C14H15BrF3NO2 |
| Molecular Weight | 366.18 g/mol |
| Exact Mass | 365.02 |
| IUPAC Name | 2-[4-bromo-2-(trifluoromethyl)anilino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCCCC1Nc1ccc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C14H15BrF3NO2/c15-8-5-6-12(10(7-8)14(16,17)18)19-11-4-2-1-3-9(11)13(20)21/h5-7,9,11,19H,1-4H2,(H,20,21) |
| InChIKey | XERLNFVZGCOIPH-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.18 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |