C15H18F3NO3S — CID 133473451
2-cyclopropyl-N-[2-(trifluoromethylsulfonyl)phenyl]oxan-4-amine (PubChem CID 133473451) has the molecular formula C15H18F3NO3S and a molecular weight of 349.37 g/mol. Its IUPAC name is 2-cyclopropyl-N-[2-(trifluoromethylsulfonyl)phenyl]oxan-4-amine.
| Compound Name | 2-cyclopropyl-N-[2-(trifluoromethylsulfonyl)phenyl]oxan-4-amine |
|---|---|
| PubChem CID | 133473451 |
| Molecular Formula | C15H18F3NO3S |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 2-cyclopropyl-N-[2-(trifluoromethylsulfonyl)phenyl]oxan-4-amine |
| SMILES | O=S(=O)(c1ccccc1NC1CCOC(C2CC2)C1)C(F)(F)F |
| InChI | InChI=1S/C15H18F3NO3S/c16-15(17,18)23(20,21)14-4-2-1-3-12(14)19-11-7-8-22-13(9-11)10-5-6-10/h1-4,10-11,13,19H,5-9H2 |
| InChIKey | SSFLIGABLHYNPI-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |