C18H19ClN4O2 — CID 170338197
2-chloro-N-[6-cyano-4-[[(2R,4R)-2-methyloxan-4-yl]amino]quinolin-3-yl]acetamide (PubChem CID 170338197) has the molecular formula C18H19ClN4O2 and a molecular weight of 358.83 g/mol. Its IUPAC name is 2-chloro-N-[6-cyano-4-[[(2R,4R)-2-methyloxan-4-yl]amino]quinolin-3-yl]acetamide.
| Compound Name | 2-chloro-N-[6-cyano-4-[[(2R,4R)-2-methyloxan-4-yl]amino]quinolin-3-yl]acetamide |
|---|---|
| PubChem CID | 170338197 |
| Molecular Formula | C18H19ClN4O2 |
| Molecular Weight | 358.83 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 2-chloro-N-[6-cyano-4-[[(2R,4R)-2-methyloxan-4-yl]amino]quinolin-3-yl]acetamide |
| SMILES | C[C@@H]1C[C@H](Nc2c(NC(=O)CCl)cnc3ccc(C#N)cc23)CCO1 |
| InChI | InChI=1S/C18H19ClN4O2/c1-11-6-13(4-5-25-11)22-18-14-7-12(9-20)2-3-15(14)21-10-16(18)23-17(24)8-19/h2-3,7,10-11,13H,4-6,8H2,1H3,(H,21,22)(H,23,24)/t11-,13-/m1/s1 |
| InChIKey | YLWXBKILHHAKMS-DGCLKSJQSA-N |
| XLogP | 3.26 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.83 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|