C17H20N4O — CID 142423727
3-amino-4-[(2,2-dimethyloxan-4-yl)amino]quinoline-6-carbonitrile (PubChem CID 142423727) has the molecular formula C17H20N4O and a molecular weight of 296.37 g/mol. Its IUPAC name is 3-amino-4-[(2,2-dimethyloxan-4-yl)amino]quinoline-6-carbonitrile.
| Compound Name | 3-amino-4-[(2,2-dimethyloxan-4-yl)amino]quinoline-6-carbonitrile |
|---|---|
| PubChem CID | 142423727 |
| Molecular Formula | C17H20N4O |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 3-amino-4-[(2,2-dimethyloxan-4-yl)amino]quinoline-6-carbonitrile |
| SMILES | CC1(C)CC(Nc2c(N)cnc3ccc(C#N)cc23)CCO1 |
| InChI | InChI=1S/C17H20N4O/c1-17(2)8-12(5-6-22-17)21-16-13-7-11(9-18)3-4-15(13)20-10-14(16)19/h3-4,7,10,12H,5-6,8,19H2,1-2H3,(H,20,21) |
| InChIKey | FJPWMTSCFFBIPY-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |