C14H17N3O3 — CID 78965421
4-[(2,2-dimethyloxan-4-yl)amino]-3-nitrobenzonitrile (PubChem CID 78965421) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is 4-[(2,2-dimethyloxan-4-yl)amino]-3-nitrobenzonitrile.
| Compound Name | 4-[(2,2-dimethyloxan-4-yl)amino]-3-nitrobenzonitrile |
|---|---|
| PubChem CID | 78965421 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 4-[(2,2-dimethyloxan-4-yl)amino]-3-nitrobenzonitrile |
| SMILES | CC1(C)CC(Nc2ccc(C#N)cc2[N+](=O)[O-])CCO1 |
| InChI | InChI=1S/C14H17N3O3/c1-14(2)8-11(5-6-20-14)16-12-4-3-10(9-15)7-13(12)17(18)19/h3-4,7,11,16H,5-6,8H2,1-2H3 |
| InChIKey | PQXKEQBMTBXIEF-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 88.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|