C16H21N3O2 — CID 78965082
3-nitro-4-[(3,3,5-trimethylcyclohexyl)amino]benzonitrile (PubChem CID 78965082) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is 3-nitro-4-[(3,3,5-trimethylcyclohexyl)amino]benzonitrile.
| Compound Name | 3-nitro-4-[(3,3,5-trimethylcyclohexyl)amino]benzonitrile |
|---|---|
| PubChem CID | 78965082 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 3-nitro-4-[(3,3,5-trimethylcyclohexyl)amino]benzonitrile |
| SMILES | CC1CC(Nc2ccc(C#N)cc2[N+](=O)[O-])CC(C)(C)C1 |
| InChI | InChI=1S/C16H21N3O2/c1-11-6-13(9-16(2,3)8-11)18-14-5-4-12(10-17)7-15(14)19(20)21/h4-5,7,11,13,18H,6,8-9H2,1-3H3 |
| InChIKey | MKVNCZKETAXTHP-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|