C16H21ClN2 — CID 43681600
4-chloro-2-[(3,3,5-trimethylcyclohexyl)amino]benzonitrile (PubChem CID 43681600) has the molecular formula C16H21ClN2 and a molecular weight of 276.81 g/mol. Its IUPAC name is 4-chloro-2-[(3,3,5-trimethylcyclohexyl)amino]benzonitrile.
| Compound Name | 4-chloro-2-[(3,3,5-trimethylcyclohexyl)amino]benzonitrile |
|---|---|
| PubChem CID | 43681600 |
| Molecular Formula | C16H21ClN2 |
| Molecular Weight | 276.81 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 4-chloro-2-[(3,3,5-trimethylcyclohexyl)amino]benzonitrile |
| SMILES | CC1CC(Nc2cc(Cl)ccc2C#N)CC(C)(C)C1 |
| InChI | InChI=1S/C16H21ClN2/c1-11-6-14(9-16(2,3)8-11)19-15-7-13(17)5-4-12(15)10-18/h4-5,7,11,14,19H,6,8-9H2,1-3H3 |
| InChIKey | KFAZCHWMUWGZTC-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.81 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |