C15H19N3O3 — CID 78997053
4-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]-3-nitrobenzonitrile (PubChem CID 78997053) has the molecular formula C15H19N3O3 and a molecular weight of 289.34 g/mol. Its IUPAC name is 4-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]-3-nitrobenzonitrile.
| Compound Name | 4-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]-3-nitrobenzonitrile |
|---|---|
| PubChem CID | 78997053 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 4-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]-3-nitrobenzonitrile |
| SMILES | CCOC1CC(Nc2ccc(C#N)cc2[N+](=O)[O-])C1(C)C |
| InChI | InChI=1S/C15H19N3O3/c1-4-21-14-8-13(15(14,2)3)17-11-6-5-10(9-16)7-12(11)18(19)20/h5-7,13-14,17H,4,8H2,1-3H3 |
| InChIKey | OZBNXNFPHBNTNY-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 88.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|