C16H19N3O4 — CID 126666776
6-methoxy-N-[(2S,4S)-2-methyloxan-4-yl]-3-nitroquinolin-4-amine (PubChem CID 126666776) has the molecular formula C16H19N3O4 and a molecular weight of 317.35 g/mol. Its IUPAC name is 6-methoxy-N-[(2S,4S)-2-methyloxan-4-yl]-3-nitroquinolin-4-amine.
| Compound Name | 6-methoxy-N-[(2S,4S)-2-methyloxan-4-yl]-3-nitroquinolin-4-amine |
|---|---|
| PubChem CID | 126666776 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 6-methoxy-N-[(2S,4S)-2-methyloxan-4-yl]-3-nitroquinolin-4-amine |
| SMILES | COc1ccc2ncc([N+](=O)[O-])c(N[C@H]3CCO[C@@H](C)C3)c2c1 |
| InChI | InChI=1S/C16H19N3O4/c1-10-7-11(5-6-23-10)18-16-13-8-12(22-2)3-4-14(13)17-9-15(16)19(20)21/h3-4,8-11H,5-7H2,1-2H3,(H,17,18)/t10-,11-/m0/s1 |
| InChIKey | FAAQWHJXZQNPBP-QWRGUYRKSA-N |
| XLogP | 3.13 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|