About 6-chloro-N-[(2R,4R)-2-ethyloxan-4-yl]-3-nitroquinolin-4-amine
6-chloro-N-[(2R,4R)-2-ethyloxan-4-yl]-3-nitroquinolin-4-amine (PubChem CID 159342407) has the molecular formula C16H18ClN3O3
and a molecular weight of 335.79 g/mol. Its IUPAC name is 6-chloro-N-[(2R,4R)-2-ethyloxan-4-yl]-3-nitroquinolin-4-amine.
Molecular Properties
| Compound Name | 6-chloro-N-[(2R,4R)-2-ethyloxan-4-yl]-3-nitroquinolin-4-amine |
| PubChem CID | 159342407 |
| Molecular Formula | C16H18ClN3O3 |
| Molecular Weight | 335.79 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 6-chloro-N-[(2R,4R)-2-ethyloxan-4-yl]-3-nitroquinolin-4-amine |
| SMILES | CC[C@@H]1C[C@H](Nc2c([N+](=O)[O-])cnc3ccc(Cl)cc23)CCO1 |
| InChI | InChI=1S/C16H18ClN3O3/c1-2-12-8-11(5-6-23-12)19-16-13-7-10(17)3-4-14(13)18-9-15(16)20(21)22/h3-4,7,9,11-12H,2,5-6,8H2,1H3,(H,18,19)/t11-,12-/m1/s1 |
| InChIKey | GMMJVPXZMGVDEX-VXGBXAGGSA-N |
| XLogP | 4.17 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.79 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-N-[(2R,4R)-2-ethyloxan-4-yl]-3-nitroquinolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-N-[(2R,4R)-2-ethyloxan-4-yl]-3-nitroquinolin-4-amine?
The IUPAC name of 6-chloro-N-[(2R,4R)-2-ethyloxan-4-yl]-3-nitroquinolin-4-amine (CID 159342407) is 6-chloro-N-[(2R,4R)-2-ethyloxan-4-yl]-3-nitroquinolin-4-amine.
What is the SMILES notation for 6-chloro-N-[(2R,4R)-2-ethyloxan-4-yl]-3-nitroquinolin-4-amine?
The canonical SMILES for 6-chloro-N-[(2R,4R)-2-ethyloxan-4-yl]-3-nitroquinolin-4-amine is CC[C@@H]1C[C@H](Nc2c([N+](=O)[O-])cnc3ccc(Cl)cc23)CCO1.
What is the InChIKey of 6-chloro-N-[(2R,4R)-2-ethyloxan-4-yl]-3-nitroquinolin-4-amine?
The InChIKey is GMMJVPXZMGVDEX-VXGBXAGGSA-N. The full InChI is InChI=1S/C16H18ClN3O3/c1-2-12-8-11(5-6-23-12)19-16-13-7-10(17)3-4-14(13)18-9-15(16)20(21)22/h3-4,7,9,11-12H,2,5-6,8H2,1H3,(H,18,19)/t11-,12-/m1/s1.
What are the key properties of 6-chloro-N-[(2R,4R)-2-ethyloxan-4-yl]-3-nitroquinolin-4-amine?
6-chloro-N-[(2R,4R)-2-ethyloxan-4-yl]-3-nitroquinolin-4-amine has a molecular weight of 335.79 g/mol, XLogP of 4.17, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-N-[(2R,4R)-2-ethyloxan-4-yl]-3-nitroquinolin-4-amine is sourced from PubChem (CID 159342407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).