C16H18ClN3O3 — CID 159342407
6-chloro-N-[(2R,4R)-2-ethyloxan-4-yl]-3-nitroquinolin-4-amine (PubChem CID 159342407) has the molecular formula C16H18ClN3O3 and a molecular weight of 335.79 g/mol. Its IUPAC name is 6-chloro-N-[(2R,4R)-2-ethyloxan-4-yl]-3-nitroquinolin-4-amine.
| Compound Name | 6-chloro-N-[(2R,4R)-2-ethyloxan-4-yl]-3-nitroquinolin-4-amine |
|---|---|
| PubChem CID | 159342407 |
| Molecular Formula | C16H18ClN3O3 |
| Molecular Weight | 335.79 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 6-chloro-N-[(2R,4R)-2-ethyloxan-4-yl]-3-nitroquinolin-4-amine |
| SMILES | CC[C@@H]1C[C@H](Nc2c([N+](=O)[O-])cnc3ccc(Cl)cc23)CCO1 |
| InChI | InChI=1S/C16H18ClN3O3/c1-2-12-8-11(5-6-23-12)19-16-13-7-10(17)3-4-14(13)18-9-15(16)20(21)22/h3-4,7,9,11-12H,2,5-6,8H2,1H3,(H,18,19)/t11-,12-/m1/s1 |
| InChIKey | GMMJVPXZMGVDEX-VXGBXAGGSA-N |
| XLogP | 4.17 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.79 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|