C16H16N4O3 — CID 140778445
6-isocyano-N-[(2R,4R)-2-methyloxan-4-yl]-3-nitroquinolin-4-amine (PubChem CID 140778445) has the molecular formula C16H16N4O3 and a molecular weight of 312.33 g/mol. Its IUPAC name is 6-isocyano-N-[(2R,4R)-2-methyloxan-4-yl]-3-nitroquinolin-4-amine.
| Compound Name | 6-isocyano-N-[(2R,4R)-2-methyloxan-4-yl]-3-nitroquinolin-4-amine |
|---|---|
| PubChem CID | 140778445 |
| Molecular Formula | C16H16N4O3 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 6-isocyano-N-[(2R,4R)-2-methyloxan-4-yl]-3-nitroquinolin-4-amine |
| SMILES | [C-]#[N+]c1ccc2ncc([N+](=O)[O-])c(N[C@@H]3CCO[C@H](C)C3)c2c1 |
| InChI | InChI=1S/C16H16N4O3/c1-10-7-12(5-6-23-10)19-16-13-8-11(17-2)3-4-14(13)18-9-15(16)20(21)22/h3-4,8-10,12H,5-7H2,1H3,(H,18,19)/t10-,12-/m1/s1 |
| InChIKey | FFQXNPGLEVGMEV-ZYHUDNBSSA-N |
| XLogP | 3.67 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|