C24H26FN3O5 — CID 135324897
N-[(2,4-dimethoxyphenyl)methyl]-6-fluoro-N-[(2S,4R)-2-methyloxan-4-yl]-3-nitroquinolin-4-amine (PubChem CID 135324897) has the molecular formula C24H26FN3O5 and a molecular weight of 455.49 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methyl]-6-fluoro-N-[(2S,4R)-2-methyloxan-4-yl]-3-nitroquinolin-4-amine.
| Compound Name | N-[(2,4-dimethoxyphenyl)methyl]-6-fluoro-N-[(2S,4R)-2-methyloxan-4-yl]-3-nitroquinolin-4-amine |
|---|---|
| PubChem CID | 135324897 |
| Molecular Formula | C24H26FN3O5 |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methyl]-6-fluoro-N-[(2S,4R)-2-methyloxan-4-yl]-3-nitroquinolin-4-amine |
| SMILES | COc1ccc(CN(c2c([N+](=O)[O-])cnc3ccc(F)cc23)[C@@H]2CCO[C@@H](C)C2)c(OC)c1 |
| InChI | InChI=1S/C24H26FN3O5/c1-15-10-18(8-9-33-15)27(14-16-4-6-19(31-2)12-23(16)32-3)24-20-11-17(25)5-7-21(20)26-13-22(24)28(29)30/h4-7,11-13,15,18H,8-10,14H2,1-3H3/t15-,18+/m0/s1 |
| InChIKey | JNLQTJASRODXRX-MAUKXSAKSA-N |
| XLogP | 4.87 |
| TPSA | 86.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|