C14H9ClF2N2 — CID 107933151
4-(3-chloro-4-methylanilino)-2,3-difluorobenzonitrile (PubChem CID 107933151) has the molecular formula C14H9ClF2N2 and a molecular weight of 278.69 g/mol. Its IUPAC name is 4-(3-chloro-4-methylanilino)-2,3-difluorobenzonitrile.
| Compound Name | 4-(3-chloro-4-methylanilino)-2,3-difluorobenzonitrile |
|---|---|
| PubChem CID | 107933151 |
| Molecular Formula | C14H9ClF2N2 |
| Molecular Weight | 278.69 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 4-(3-chloro-4-methylanilino)-2,3-difluorobenzonitrile |
| SMILES | Cc1ccc(Nc2ccc(C#N)c(F)c2F)cc1Cl |
| InChI | InChI=1S/C14H9ClF2N2/c1-8-2-4-10(6-11(8)15)19-12-5-3-9(7-18)13(16)14(12)17/h2-6,19H,1H3 |
| InChIKey | IFCGSUXBNRZWMA-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.69 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |